C29H28N4O3 — CID 91557518
3,5-bis(4-cyanophenoxy)-N-(1-propylpiperidin-4-yl)benzamide (PubChem CID 91557518) has the molecular formula C29H28N4O3 and a molecular weight of 480.57 g/mol. Its IUPAC name is 3,5-bis(4-cyanophenoxy)-N-(1-propylpiperidin-4-yl)benzamide.
| Compound Name | 3,5-bis(4-cyanophenoxy)-N-(1-propylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 91557518 |
| Molecular Formula | C29H28N4O3 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 3,5-bis(4-cyanophenoxy)-N-(1-propylpiperidin-4-yl)benzamide |
| SMILES | CCCN1CCC(NC(=O)c2cc(Oc3ccc(C#N)cc3)cc(Oc3ccc(C#N)cc3)c2)CC1 |
| InChI | InChI=1S/C29H28N4O3/c1-2-13-33-14-11-24(12-15-33)32-29(34)23-16-27(35-25-7-3-21(19-30)4-8-25)18-28(17-23)36-26-9-5-22(20-31)6-10-26/h3-10,16-18,24H,2,11-15H2,1H3,(H,32,34) |
| InChIKey | RODFXWVPZPMKFR-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |