C26H28N4O5 — CID 141280481
[4-[[3-(4-cyanobutoxy)-5-(4-cyanophenoxy)benzoyl]amino]cyclohexyl]carbamic acid (PubChem CID 141280481) has the molecular formula C26H28N4O5 and a molecular weight of 476.53 g/mol. Its IUPAC name is [4-[[3-(4-cyanobutoxy)-5-(4-cyanophenoxy)benzoyl]amino]cyclohexyl]carbamic acid.
| Compound Name | [4-[[3-(4-cyanobutoxy)-5-(4-cyanophenoxy)benzoyl]amino]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 141280481 |
| Molecular Formula | C26H28N4O5 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | [4-[[3-(4-cyanobutoxy)-5-(4-cyanophenoxy)benzoyl]amino]cyclohexyl]carbamic acid |
| SMILES | N#CCCCCOc1cc(Oc2ccc(C#N)cc2)cc(C(=O)NC2CCC(NC(=O)O)CC2)c1 |
| InChI | InChI=1S/C26H28N4O5/c27-12-2-1-3-13-34-23-14-19(15-24(16-23)35-22-10-4-18(17-28)5-11-22)25(31)29-20-6-8-21(9-7-20)30-26(32)33/h4-5,10-11,14-16,20-21,30H,1-3,6-9,13H2,(H,29,31)(H,32,33) |
| InChIKey | QTUKOINDHWXNEH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 144.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|