C26H22N6O5 — CID 141280425
[4-[[3,5-bis[(5-cyano-2-pyridinyl)oxy]benzoyl]amino]cyclohexyl]carbamic acid (PubChem CID 141280425) has the molecular formula C26H22N6O5 and a molecular weight of 498.50 g/mol. Its IUPAC name is [4-[[3,5-bis[(5-cyano-2-pyridinyl)oxy]benzoyl]amino]cyclohexyl]carbamic acid.
| Compound Name | [4-[[3,5-bis[(5-cyano-2-pyridinyl)oxy]benzoyl]amino]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 141280425 |
| Molecular Formula | C26H22N6O5 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | [4-[[3,5-bis[(5-cyano-2-pyridinyl)oxy]benzoyl]amino]cyclohexyl]carbamic acid |
| SMILES | N#Cc1ccc(Oc2cc(Oc3ccc(C#N)cn3)cc(C(=O)NC3CCC(NC(=O)O)CC3)c2)nc1 |
| InChI | InChI=1S/C26H22N6O5/c27-12-16-1-7-23(29-14-16)36-21-9-18(10-22(11-21)37-24-8-2-17(13-28)15-30-24)25(33)31-19-3-5-20(6-4-19)32-26(34)35/h1-2,7-11,14-15,19-20,32H,3-6H2,(H,31,33)(H,34,35) |
| InChIKey | ONXZIDHBYJGRCN-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 170.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |