C21H14N4O4 — CID 66818619
ethyl 3,5-bis[(5-cyano-2-pyridinyl)oxy]benzoate (PubChem CID 66818619) has the molecular formula C21H14N4O4 and a molecular weight of 386.37 g/mol. Its IUPAC name is ethyl 3,5-bis[(5-cyano-2-pyridinyl)oxy]benzoate.
| Compound Name | ethyl 3,5-bis[(5-cyano-2-pyridinyl)oxy]benzoate |
|---|---|
| PubChem CID | 66818619 |
| Molecular Formula | C21H14N4O4 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | ethyl 3,5-bis[(5-cyano-2-pyridinyl)oxy]benzoate |
| SMILES | CCOC(=O)c1cc(Oc2ccc(C#N)cn2)cc(Oc2ccc(C#N)cn2)c1 |
| InChI | InChI=1S/C21H14N4O4/c1-2-27-21(26)16-7-17(28-19-5-3-14(10-22)12-24-19)9-18(8-16)29-20-6-4-15(11-23)13-25-20/h3-9,12-13H,2H2,1H3 |
| InChIKey | NLCHJHVTBRLUSI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 118.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |