C20H19NO5 — CID 7643441
diethyl 5-[(4-cyanophenyl)methoxy]benzene-1,3-dicarboxylate (PubChem CID 7643441) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is diethyl 5-[(4-cyanophenyl)methoxy]benzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-[(4-cyanophenyl)methoxy]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 7643441 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | diethyl 5-[(4-cyanophenyl)methoxy]benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(OCc2ccc(C#N)cc2)cc(C(=O)OCC)c1 |
| InChI | InChI=1S/C20H19NO5/c1-3-24-19(22)16-9-17(20(23)25-4-2)11-18(10-16)26-13-15-7-5-14(12-21)6-8-15/h5-11H,3-4,13H2,1-2H3 |
| InChIKey | CBVXZNUNFGUGLR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |