C33H36O11 — CID 23255595
diethyl 5-[[3-[[3,5-bis(ethoxycarbonyl)phenyl]methoxy]-5-(hydroxymethyl)phenoxy]methyl]benzene-1,3-dicarboxylate (PubChem CID 23255595) has the molecular formula C33H36O11 and a molecular weight of 608.64 g/mol. Its IUPAC name is diethyl 5-[[3-[[3,5-bis(ethoxycarbonyl)phenyl]methoxy]-5-(hydroxymethyl)phenoxy]methyl]benzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-[[3-[[3,5-bis(ethoxycarbonyl)phenyl]methoxy]-5-(hydroxymethyl)phenoxy]methyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 23255595 |
| Molecular Formula | C33H36O11 |
| Molecular Weight | 608.64 g/mol |
| Exact Mass | 608.23 |
| IUPAC Name | diethyl 5-[[3-[[3,5-bis(ethoxycarbonyl)phenyl]methoxy]-5-(hydroxymethyl)phenoxy]methyl]benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(COc2cc(CO)cc(OCc3cc(C(=O)OCC)cc(C(=O)OCC)c3)c2)cc(C(=O)OCC)c1 |
| InChI | InChI=1S/C33H36O11/c1-5-39-30(35)24-9-22(10-25(15-24)31(36)40-6-2)19-43-28-13-21(18-34)14-29(17-28)44-20-23-11-26(32(37)41-7-3)16-27(12-23)33(38)42-8-4/h9-17,34H,5-8,18-20H2,1-4H3 |
| InChIKey | KDXQTWKGKMVMKH-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.64 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|