C15H20O6 — CID 59899867
diethyl 5-(ethylperoxymethyl)benzene-1,3-dicarboxylate (PubChem CID 59899867) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is diethyl 5-(ethylperoxymethyl)benzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-(ethylperoxymethyl)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 59899867 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | diethyl 5-(ethylperoxymethyl)benzene-1,3-dicarboxylate |
| SMILES | CCOOCc1cc(C(=O)OCC)cc(C(=O)OCC)c1 |
| InChI | InChI=1S/C15H20O6/c1-4-18-14(16)12-7-11(10-21-20-6-3)8-13(9-12)15(17)19-5-2/h7-9H,4-6,10H2,1-3H3 |
| InChIKey | OZDNUGFKBFHZJY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|