C13H13BrO5 — CID 134640837
3-(3-bromo-2-oxopropyl)-5-ethoxycarbonylbenzoic acid (PubChem CID 134640837) has the molecular formula C13H13BrO5 and a molecular weight of 329.15 g/mol. Its IUPAC name is 3-(3-bromo-2-oxopropyl)-5-ethoxycarbonylbenzoic acid.
| Compound Name | 3-(3-bromo-2-oxopropyl)-5-ethoxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 134640837 |
| Molecular Formula | C13H13BrO5 |
| Molecular Weight | 329.15 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 3-(3-bromo-2-oxopropyl)-5-ethoxycarbonylbenzoic acid |
| SMILES | CCOC(=O)c1cc(CC(=O)CBr)cc(C(=O)O)c1 |
| InChI | InChI=1S/C13H13BrO5/c1-2-19-13(18)10-4-8(5-11(15)7-14)3-9(6-10)12(16)17/h3-4,6H,2,5,7H2,1H3,(H,16,17) |
| InChIKey | QTKVOZLKZNKMPU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.15 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|