C19H20N2O5 — CID 15528106
diethyl 5-[[4-(hydroxymethyl)phenyl]diazenyl]benzene-1,3-dicarboxylate (PubChem CID 15528106) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is diethyl 5-[[4-(hydroxymethyl)phenyl]diazenyl]benzene-1,3-dicarboxylate.
| Compound Name | diethyl 5-[[4-(hydroxymethyl)phenyl]diazenyl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 15528106 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | diethyl 5-[[4-(hydroxymethyl)phenyl]diazenyl]benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(/N=N/c2ccc(CO)cc2)cc(C(=O)OCC)c1 |
| InChI | InChI=1S/C19H20N2O5/c1-3-25-18(23)14-9-15(19(24)26-4-2)11-17(10-14)21-20-16-7-5-13(12-22)6-8-16/h5-11,22H,3-4,12H2,1-2H3/b21-20+ |
| InChIKey | GEJCOXCTUQEWGI-QZQOTICOSA-N |
| XLogP | 3.95 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|