C25H21N5O3 — CID 67607186
2,6-bis(4-cyanophenoxy)-N-piperidin-4-ylpyridine-4-carboxamide (PubChem CID 67607186) has the molecular formula C25H21N5O3 and a molecular weight of 439.48 g/mol. Its IUPAC name is 2,6-bis(4-cyanophenoxy)-N-piperidin-4-ylpyridine-4-carboxamide.
| Compound Name | 2,6-bis(4-cyanophenoxy)-N-piperidin-4-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 67607186 |
| Molecular Formula | C25H21N5O3 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 2,6-bis(4-cyanophenoxy)-N-piperidin-4-ylpyridine-4-carboxamide |
| SMILES | N#Cc1ccc(Oc2cc(C(=O)NC3CCNCC3)cc(Oc3ccc(C#N)cc3)n2)cc1 |
| InChI | InChI=1S/C25H21N5O3/c26-15-17-1-5-21(6-2-17)32-23-13-19(25(31)29-20-9-11-28-12-10-20)14-24(30-23)33-22-7-3-18(16-27)4-8-22/h1-8,13-14,20,28H,9-12H2,(H,29,31) |
| InChIKey | VWAUXIKVVCGVFH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 120.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |