C27H24N4O3 — CID 90984394
4-[[6-(4-cyanophenoxy)-4-(4-ethylpiperidine-1-carbonyl)-2-pyridinyl]oxy]benzonitrile (PubChem CID 90984394) has the molecular formula C27H24N4O3 and a molecular weight of 452.51 g/mol. Its IUPAC name is 4-[[6-(4-cyanophenoxy)-4-(4-ethylpiperidine-1-carbonyl)-2-pyridinyl]oxy]benzonitrile.
| Compound Name | 4-[[6-(4-cyanophenoxy)-4-(4-ethylpiperidine-1-carbonyl)-2-pyridinyl]oxy]benzonitrile |
|---|---|
| PubChem CID | 90984394 |
| Molecular Formula | C27H24N4O3 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 4-[[6-(4-cyanophenoxy)-4-(4-ethylpiperidine-1-carbonyl)-2-pyridinyl]oxy]benzonitrile |
| SMILES | CCC1CCN(C(=O)c2cc(Oc3ccc(C#N)cc3)nc(Oc3ccc(C#N)cc3)c2)CC1 |
| InChI | InChI=1S/C27H24N4O3/c1-2-19-11-13-31(14-12-19)27(32)22-15-25(33-23-7-3-20(17-28)4-8-23)30-26(16-22)34-24-9-5-21(18-29)6-10-24/h3-10,15-16,19H,2,11-14H2,1H3 |
| InChIKey | WCJRXYLEFJDERK-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 99.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |