C29H27N3O3 — CID 91205779
4-[[3-(4-cyanophenoxy)-5-(4-ethylpiperidine-1-carbonyl)phenoxy]methyl]benzonitrile (PubChem CID 91205779) has the molecular formula C29H27N3O3 and a molecular weight of 465.55 g/mol. Its IUPAC name is 4-[[3-(4-cyanophenoxy)-5-(4-ethylpiperidine-1-carbonyl)phenoxy]methyl]benzonitrile.
| Compound Name | 4-[[3-(4-cyanophenoxy)-5-(4-ethylpiperidine-1-carbonyl)phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 91205779 |
| Molecular Formula | C29H27N3O3 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 4-[[3-(4-cyanophenoxy)-5-(4-ethylpiperidine-1-carbonyl)phenoxy]methyl]benzonitrile |
| SMILES | CCC1CCN(C(=O)c2cc(OCc3ccc(C#N)cc3)cc(Oc3ccc(C#N)cc3)c2)CC1 |
| InChI | InChI=1S/C29H27N3O3/c1-2-21-11-13-32(14-12-21)29(33)25-15-27(34-20-24-5-3-22(18-30)4-6-24)17-28(16-25)35-26-9-7-23(19-31)8-10-26/h3-10,15-17,21H,2,11-14,20H2,1H3 |
| InChIKey | PNYBUYSUNFCQQJ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 86.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |