C21H25N3O5 — CID 141280419
[4-[[3-[4-(aminomethyl)phenoxy]-5-hydroxybenzoyl]amino]cyclohexyl]carbamic acid (PubChem CID 141280419) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is [4-[[3-[4-(aminomethyl)phenoxy]-5-hydroxybenzoyl]amino]cyclohexyl]carbamic acid.
| Compound Name | [4-[[3-[4-(aminomethyl)phenoxy]-5-hydroxybenzoyl]amino]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 141280419 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | [4-[[3-[4-(aminomethyl)phenoxy]-5-hydroxybenzoyl]amino]cyclohexyl]carbamic acid |
| SMILES | NCc1ccc(Oc2cc(O)cc(C(=O)NC3CCC(NC(=O)O)CC3)c2)cc1 |
| InChI | InChI=1S/C21H25N3O5/c22-12-13-1-7-18(8-2-13)29-19-10-14(9-17(25)11-19)20(26)23-15-3-5-16(6-4-15)24-21(27)28/h1-2,7-11,15-16,24-25H,3-6,12,22H2,(H,23,26)(H,27,28) |
| InChIKey | PJNZCBZDVAGZSB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |