C21H26ClN3O3 — CID 165436550
benzyl 4-[[4-(aminomethyl)benzoyl]amino]piperidine-1-carboxylate;hydrochloride (PubChem CID 165436550) has the molecular formula C21H26ClN3O3 and a molecular weight of 403.91 g/mol. Its IUPAC name is benzyl 4-[[4-(aminomethyl)benzoyl]amino]piperidine-1-carboxylate;hydrochloride.
| Compound Name | benzyl 4-[[4-(aminomethyl)benzoyl]amino]piperidine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 165436550 |
| Molecular Formula | C21H26ClN3O3 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | benzyl 4-[[4-(aminomethyl)benzoyl]amino]piperidine-1-carboxylate;hydrochloride |
| SMILES | Cl.NCc1ccc(C(=O)NC2CCN(C(=O)OCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C21H25N3O3.ClH/c22-14-16-6-8-18(9-7-16)20(25)23-19-10-12-24(13-11-19)21(26)27-15-17-4-2-1-3-5-17;/h1-9,19H,10-15,22H2,(H,23,25);1H |
| InChIKey | YJAHUHVJCZHOCV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |