C18H26N2O5 — CID 108562757
benzyl 4-[[2-(2-methoxyethoxy)acetyl]amino]piperidine-1-carboxylate (PubChem CID 108562757) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is benzyl 4-[[2-(2-methoxyethoxy)acetyl]amino]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[[2-(2-methoxyethoxy)acetyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108562757 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | benzyl 4-[[2-(2-methoxyethoxy)acetyl]amino]piperidine-1-carboxylate |
| SMILES | COCCOCC(=O)NC1CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C18H26N2O5/c1-23-11-12-24-14-17(21)19-16-7-9-20(10-8-16)18(22)25-13-15-5-3-2-4-6-15/h2-6,16H,7-14H2,1H3,(H,19,21) |
| InChIKey | WGQRTCBUDUYYOM-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|