C30H32N6O7 — CID 141280420
N-[3,5-bis[4-(N-acetyl-N-hydroxycarbamimidoyl)phenoxy]phenyl]piperidine-4-carboxamide (PubChem CID 141280420) has the molecular formula C30H32N6O7 and a molecular weight of 588.62 g/mol. Its IUPAC name is N-[3,5-bis[4-(N-acetyl-N-hydroxycarbamimidoyl)phenoxy]phenyl]piperidine-4-carboxamide.
| Compound Name | N-[3,5-bis[4-(N-acetyl-N-hydroxycarbamimidoyl)phenoxy]phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 141280420 |
| Molecular Formula | C30H32N6O7 |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | N-[3,5-bis[4-(N-acetyl-N-hydroxycarbamimidoyl)phenoxy]phenyl]piperidine-4-carboxamide |
| SMILES | [H]/N=C(/c1ccc(Oc2cc(NC(=O)C3CCNCC3)cc(Oc3ccc(/C(=N/[H])N(O)C(C)=O)cc3)c2)cc1)N(O)C(C)=O |
| InChI | InChI=1S/C30H32N6O7/c1-18(37)35(40)28(31)20-3-7-24(8-4-20)42-26-15-23(34-30(39)22-11-13-33-14-12-22)16-27(17-26)43-25-9-5-21(6-10-25)29(32)36(41)19(2)38/h3-10,15-17,22,31-33,40-41H,11-14H2,1-2H3,(H,34,39)/b31-28-,32-29- |
| InChIKey | YZVFFWHWRWLBNJ-UEMBWUHXSA-N |
| XLogP | 4.34 |
| TPSA | 188.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|