C27H27N5O7 — CID 91075205
1-[3,5-bis[4-(N'-hydroxycarbamimidoyl)phenoxy]benzoyl]piperidine-4-carboxylic acid (PubChem CID 91075205) has the molecular formula C27H27N5O7 and a molecular weight of 533.54 g/mol. Its IUPAC name is 1-[3,5-bis[4-(N'-hydroxycarbamimidoyl)phenoxy]benzoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[3,5-bis[4-(N'-hydroxycarbamimidoyl)phenoxy]benzoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 91075205 |
| Molecular Formula | C27H27N5O7 |
| Molecular Weight | 533.54 g/mol |
| Exact Mass | 533.19 |
| IUPAC Name | 1-[3,5-bis[4-(N'-hydroxycarbamimidoyl)phenoxy]benzoyl]piperidine-4-carboxylic acid |
| SMILES | NC(=NO)c1ccc(Oc2cc(Oc3ccc(C(N)=NO)cc3)cc(C(=O)N3CCC(C(=O)O)CC3)c2)cc1 |
| InChI | InChI=1S/C27H27N5O7/c28-24(30-36)16-1-5-20(6-2-16)38-22-13-19(26(33)32-11-9-18(10-12-32)27(34)35)14-23(15-22)39-21-7-3-17(4-8-21)25(29)31-37/h1-8,13-15,18,36-37H,9-12H2,(H2,28,30)(H2,29,31)(H,34,35) |
| InChIKey | VUFVMFOJGAVQOZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 193.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|