C24H33N5O3 — CID 66818658
4-[3-[4-(2-aminoethyl)piperidine-1-carbonyl]-5-(3-aminopropoxy)phenoxy]benzenecarboximidamide (PubChem CID 66818658) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 4-[3-[4-(2-aminoethyl)piperidine-1-carbonyl]-5-(3-aminopropoxy)phenoxy]benzenecarboximidamide.
| Compound Name | 4-[3-[4-(2-aminoethyl)piperidine-1-carbonyl]-5-(3-aminopropoxy)phenoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 66818658 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | 4-[3-[4-(2-aminoethyl)piperidine-1-carbonyl]-5-(3-aminopropoxy)phenoxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Oc2cc(OCCCN)cc(C(=O)N3CCC(CCN)CC3)c2)cc1 |
| InChI | InChI=1S/C24H33N5O3/c25-9-1-13-31-21-14-19(24(30)29-11-7-17(6-10-26)8-12-29)15-22(16-21)32-20-4-2-18(3-5-20)23(27)28/h2-5,14-17H,1,6-13,25-26H2,(H3,27,28) |
| InChIKey | KPMRBGBKOWLJPA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 140.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|