C27H31N7O3 — CID 66818737
4-[3-[4-(2-aminoethyl)piperazine-1-carbonyl]-5-(4-carbamimidoylphenoxy)phenoxy]benzenecarboximidamide (PubChem CID 66818737) has the molecular formula C27H31N7O3 and a molecular weight of 501.59 g/mol. Its IUPAC name is 4-[3-[4-(2-aminoethyl)piperazine-1-carbonyl]-5-(4-carbamimidoylphenoxy)phenoxy]benzenecarboximidamide.
| Compound Name | 4-[3-[4-(2-aminoethyl)piperazine-1-carbonyl]-5-(4-carbamimidoylphenoxy)phenoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 66818737 |
| Molecular Formula | C27H31N7O3 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | 4-[3-[4-(2-aminoethyl)piperazine-1-carbonyl]-5-(4-carbamimidoylphenoxy)phenoxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Oc2cc(Oc3ccc(/C(N)=N/[H])cc3)cc(C(=O)N3CCN(CCN)CC3)c2)cc1 |
| InChI | InChI=1S/C27H31N7O3/c28-9-10-33-11-13-34(14-12-33)27(35)20-15-23(36-21-5-1-18(2-6-21)25(29)30)17-24(16-20)37-22-7-3-19(4-8-22)26(31)32/h1-8,15-17H,9-14,28H2,(H3,29,30)(H3,31,32) |
| InChIKey | OSXSWWIUXQMYGI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|