C29H33N3O4 — CID 141280450
4-[3-[4-(2-aminoethyl)piperidine-1-carbonyl]-5-(2-phenylethoxy)phenoxy]benzamide (PubChem CID 141280450) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is 4-[3-[4-(2-aminoethyl)piperidine-1-carbonyl]-5-(2-phenylethoxy)phenoxy]benzamide.
| Compound Name | 4-[3-[4-(2-aminoethyl)piperidine-1-carbonyl]-5-(2-phenylethoxy)phenoxy]benzamide |
|---|---|
| PubChem CID | 141280450 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 4-[3-[4-(2-aminoethyl)piperidine-1-carbonyl]-5-(2-phenylethoxy)phenoxy]benzamide |
| SMILES | NCCC1CCN(C(=O)c2cc(OCCc3ccccc3)cc(Oc3ccc(C(N)=O)cc3)c2)CC1 |
| InChI | InChI=1S/C29H33N3O4/c30-14-10-22-11-15-32(16-12-22)29(34)24-18-26(35-17-13-21-4-2-1-3-5-21)20-27(19-24)36-25-8-6-23(7-9-25)28(31)33/h1-9,18-20,22H,10-17,30H2,(H2,31,33) |
| InChIKey | JZJMXAGZBYRJOO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |