C20H23ClN4O3 — CID 18933509
2-[4-[4-(4-carbamimidoylphenyl)benzoyl]piperazin-1-yl]acetic acid;hydrochloride (PubChem CID 18933509) has the molecular formula C20H23ClN4O3 and a molecular weight of 402.88 g/mol. Its IUPAC name is 2-[4-[4-(4-carbamimidoylphenyl)benzoyl]piperazin-1-yl]acetic acid;hydrochloride.
| Compound Name | 2-[4-[4-(4-carbamimidoylphenyl)benzoyl]piperazin-1-yl]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 18933509 |
| Molecular Formula | C20H23ClN4O3 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 2-[4-[4-(4-carbamimidoylphenyl)benzoyl]piperazin-1-yl]acetic acid;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(-c2ccc(C(=O)N3CCN(CC(=O)O)CC3)cc2)cc1 |
| InChI | InChI=1S/C20H22N4O3.ClH/c21-19(22)16-5-1-14(2-6-16)15-3-7-17(8-4-15)20(27)24-11-9-23(10-12-24)13-18(25)26;/h1-8H,9-13H2,(H3,21,22)(H,25,26);1H |
| InChIKey | PAKPXIUYTUIHMY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|