C26H34ClN3O3 — CID 67879973
pentan-3-yl 2-[1-[4-(4-carbamimidoylphenyl)benzoyl]piperidin-4-yl]acetate;hydrochloride (PubChem CID 67879973) has the molecular formula C26H34ClN3O3 and a molecular weight of 472.03 g/mol. Its IUPAC name is pentan-3-yl 2-[1-[4-(4-carbamimidoylphenyl)benzoyl]piperidin-4-yl]acetate;hydrochloride.
| Compound Name | pentan-3-yl 2-[1-[4-(4-carbamimidoylphenyl)benzoyl]piperidin-4-yl]acetate;hydrochloride |
|---|---|
| PubChem CID | 67879973 |
| Molecular Formula | C26H34ClN3O3 |
| Molecular Weight | 472.03 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | pentan-3-yl 2-[1-[4-(4-carbamimidoylphenyl)benzoyl]piperidin-4-yl]acetate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(-c2ccc(C(=O)N3CCC(CC(=O)OC(CC)CC)CC3)cc2)cc1 |
| InChI | InChI=1S/C26H33N3O3.ClH/c1-3-23(4-2)32-24(30)17-18-13-15-29(16-14-18)26(31)22-11-7-20(8-12-22)19-5-9-21(10-6-19)25(27)28;/h5-12,18,23H,3-4,13-17H2,1-2H3,(H3,27,28);1H |
| InChIKey | HBNXAYYSKYGJFU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 96.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.03 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|