C20H23N5O3 — CID 19419661
methyl 2-[1-[2-(4-carbamimidoylphenyl)pyrimidine-5-carbonyl]piperidin-4-yl]acetate (PubChem CID 19419661) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is methyl 2-[1-[2-(4-carbamimidoylphenyl)pyrimidine-5-carbonyl]piperidin-4-yl]acetate.
| Compound Name | methyl 2-[1-[2-(4-carbamimidoylphenyl)pyrimidine-5-carbonyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 19419661 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | methyl 2-[1-[2-(4-carbamimidoylphenyl)pyrimidine-5-carbonyl]piperidin-4-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(-c2ncc(C(=O)N3CCC(CC(=O)OC)CC3)cn2)cc1 |
| InChI | InChI=1S/C20H23N5O3/c1-28-17(26)10-13-6-8-25(9-7-13)20(27)16-11-23-19(24-12-16)15-4-2-14(3-5-15)18(21)22/h2-5,11-13H,6-10H2,1H3,(H3,21,22) |
| InChIKey | VSOLUUFKBGNWCM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 122.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|