C19H20N6O4 — CID 19419735
methyl 2-[4-[5-(4-carbamimidoylphenyl)pyrimidine-2-carbonyl]-2-oxopiperazin-1-yl]acetate (PubChem CID 19419735) has the molecular formula C19H20N6O4 and a molecular weight of 396.41 g/mol. Its IUPAC name is methyl 2-[4-[5-(4-carbamimidoylphenyl)pyrimidine-2-carbonyl]-2-oxopiperazin-1-yl]acetate.
| Compound Name | methyl 2-[4-[5-(4-carbamimidoylphenyl)pyrimidine-2-carbonyl]-2-oxopiperazin-1-yl]acetate |
|---|---|
| PubChem CID | 19419735 |
| Molecular Formula | C19H20N6O4 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | methyl 2-[4-[5-(4-carbamimidoylphenyl)pyrimidine-2-carbonyl]-2-oxopiperazin-1-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(-c2cnc(C(=O)N3CCN(CC(=O)OC)C(=O)C3)nc2)cc1 |
| InChI | InChI=1S/C19H20N6O4/c1-29-16(27)11-24-6-7-25(10-15(24)26)19(28)18-22-8-14(9-23-18)12-2-4-13(5-3-12)17(20)21/h2-5,8-9H,6-7,10-11H2,1H3,(H3,20,21) |
| InChIKey | LGSNVEHGEIQNPD-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 142.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|