C16H16N4O4 — CID 29068974
methyl 2-[2-oxo-4-(quinoxaline-2-carbonyl)piperazin-1-yl]acetate (PubChem CID 29068974) has the molecular formula C16H16N4O4 and a molecular weight of 328.33 g/mol. Its IUPAC name is methyl 2-[2-oxo-4-(quinoxaline-2-carbonyl)piperazin-1-yl]acetate.
| Compound Name | methyl 2-[2-oxo-4-(quinoxaline-2-carbonyl)piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 29068974 |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | methyl 2-[2-oxo-4-(quinoxaline-2-carbonyl)piperazin-1-yl]acetate |
| SMILES | COC(=O)CN1CCN(C(=O)c2cnc3ccccc3n2)CC1=O |
| InChI | InChI=1S/C16H16N4O4/c1-24-15(22)10-19-6-7-20(9-14(19)21)16(23)13-8-17-11-4-2-3-5-12(11)18-13/h2-5,8H,6-7,9-10H2,1H3 |
| InChIKey | PTVFTZSVSZBCLR-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |