C17H25ClN4O3 — CID 22098622
methyl 4-[3-[2-(4-carbamimidoylphenyl)ethyl]-2-oxoimidazolidin-1-yl]butanoate;hydrochloride (PubChem CID 22098622) has the molecular formula C17H25ClN4O3 and a molecular weight of 368.87 g/mol. Its IUPAC name is methyl 4-[3-[2-(4-carbamimidoylphenyl)ethyl]-2-oxoimidazolidin-1-yl]butanoate;hydrochloride.
| Compound Name | methyl 4-[3-[2-(4-carbamimidoylphenyl)ethyl]-2-oxoimidazolidin-1-yl]butanoate;hydrochloride |
|---|---|
| PubChem CID | 22098622 |
| Molecular Formula | C17H25ClN4O3 |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | methyl 4-[3-[2-(4-carbamimidoylphenyl)ethyl]-2-oxoimidazolidin-1-yl]butanoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(CCN2CCN(CCCC(=O)OC)C2=O)cc1 |
| InChI | InChI=1S/C17H24N4O3.ClH/c1-24-15(22)3-2-9-20-11-12-21(17(20)23)10-8-13-4-6-14(7-5-13)16(18)19;/h4-7H,2-3,8-12H2,1H3,(H3,18,19);1H |
| InChIKey | KRUOMFRHSDFMPJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 99.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|