C20H22ClN5O3 — CID 19032615
methyl 3-[4-[4-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl]propanoate;hydrochloride (PubChem CID 19032615) has the molecular formula C20H22ClN5O3 and a molecular weight of 415.88 g/mol. Its IUPAC name is methyl 3-[4-[4-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl]propanoate;hydrochloride.
| Compound Name | methyl 3-[4-[4-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 19032615 |
| Molecular Formula | C20H22ClN5O3 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | methyl 3-[4-[4-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-1-yl]phenyl]propanoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(-n2c(C)nn(-c3ccc(CCC(=O)OC)cc3)c2=O)cc1 |
| InChI | InChI=1S/C20H21N5O3.ClH/c1-13-23-25(17-8-3-14(4-9-17)5-12-18(26)28-2)20(27)24(13)16-10-6-15(7-11-16)19(21)22;/h3-4,6-11H,5,12H2,1-2H3,(H3,21,22);1H |
| InChIKey | WOVKFIPNVXCGRL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 115.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|