C22H22F3N5O3 — CID 70076548
propan-2-yl 3-[4-[1-(4-carbamimidoylphenyl)-5-oxo-3-(trifluoromethyl)-1,2,4-triazol-4-yl]phenyl]propanoate (PubChem CID 70076548) has the molecular formula C22H22F3N5O3 and a molecular weight of 461.44 g/mol. Its IUPAC name is propan-2-yl 3-[4-[1-(4-carbamimidoylphenyl)-5-oxo-3-(trifluoromethyl)-1,2,4-triazol-4-yl]phenyl]propanoate.
| Compound Name | propan-2-yl 3-[4-[1-(4-carbamimidoylphenyl)-5-oxo-3-(trifluoromethyl)-1,2,4-triazol-4-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 70076548 |
| Molecular Formula | C22H22F3N5O3 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | propan-2-yl 3-[4-[1-(4-carbamimidoylphenyl)-5-oxo-3-(trifluoromethyl)-1,2,4-triazol-4-yl]phenyl]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(-n2nc(C(F)(F)F)n(-c3ccc(CCC(=O)OC(C)C)cc3)c2=O)cc1 |
| InChI | InChI=1S/C22H22F3N5O3/c1-13(2)33-18(31)12-5-14-3-8-16(9-4-14)29-20(22(23,24)25)28-30(21(29)32)17-10-6-15(7-11-17)19(26)27/h3-4,6-11,13H,5,12H2,1-2H3,(H3,26,27) |
| InChIKey | XUMAFOFARLNLRB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 115.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|