C20H20N4O2S — CID 22098876
methyl 3-[4-[5-(4-carbamimidoylphenyl)-2-sulfanylidene-1H-imidazol-3-yl]phenyl]propanoate (PubChem CID 22098876) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is methyl 3-[4-[5-(4-carbamimidoylphenyl)-2-sulfanylidene-1H-imidazol-3-yl]phenyl]propanoate.
| Compound Name | methyl 3-[4-[5-(4-carbamimidoylphenyl)-2-sulfanylidene-1H-imidazol-3-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 22098876 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | methyl 3-[4-[5-(4-carbamimidoylphenyl)-2-sulfanylidene-1H-imidazol-3-yl]phenyl]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(-c2cn(-c3ccc(CCC(=O)OC)cc3)c(=S)[nH]2)cc1 |
| InChI | InChI=1S/C20H20N4O2S/c1-26-18(25)11-4-13-2-9-16(10-3-13)24-12-17(23-20(24)27)14-5-7-15(8-6-14)19(21)22/h2-3,5-10,12H,4,11H2,1H3,(H3,21,22)(H,23,27) |
| InChIKey | APUBJRHADSFYPS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|