C20H23ClN4O2S — CID 22098520
methyl 3-[4-[3-(4-carbamimidoylphenyl)-2-sulfanylideneimidazolidin-1-yl]phenyl]propanoate;hydrochloride (PubChem CID 22098520) has the molecular formula C20H23ClN4O2S and a molecular weight of 418.95 g/mol. Its IUPAC name is methyl 3-[4-[3-(4-carbamimidoylphenyl)-2-sulfanylideneimidazolidin-1-yl]phenyl]propanoate;hydrochloride.
| Compound Name | methyl 3-[4-[3-(4-carbamimidoylphenyl)-2-sulfanylideneimidazolidin-1-yl]phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 22098520 |
| Molecular Formula | C20H23ClN4O2S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | methyl 3-[4-[3-(4-carbamimidoylphenyl)-2-sulfanylideneimidazolidin-1-yl]phenyl]propanoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(N2CCN(c3ccc(CCC(=O)OC)cc3)C2=S)cc1 |
| InChI | InChI=1S/C20H22N4O2S.ClH/c1-26-18(25)11-4-14-2-7-16(8-3-14)23-12-13-24(20(23)27)17-9-5-15(6-10-17)19(21)22;/h2-3,5-10H,4,11-13H2,1H3,(H3,21,22);1H |
| InChIKey | WHUYMRPJMBFNRJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 82.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|