C21H24N4O4 — CID 22098543
methyl 3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]-3-methoxyphenyl]propanoate (PubChem CID 22098543) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is methyl 3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]-3-methoxyphenyl]propanoate.
| Compound Name | methyl 3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]-3-methoxyphenyl]propanoate |
|---|---|
| PubChem CID | 22098543 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | methyl 3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazolidin-1-yl]-3-methoxyphenyl]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(N2CCN(c3ccc(CCC(=O)OC)cc3OC)C2=O)cc1 |
| InChI | InChI=1S/C21H24N4O4/c1-28-18-13-14(4-10-19(26)29-2)3-9-17(18)25-12-11-24(21(25)27)16-7-5-15(6-8-16)20(22)23/h3,5-9,13H,4,10-12H2,1-2H3,(H3,22,23) |
| InChIKey | XHXNSHWIRILINZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 108.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|