C29H37N5O3 — CID 70076307
(5-methyl-2-propan-2-ylcyclohexyl) 3-[4-[1-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-4-yl]phenyl]propanoate (PubChem CID 70076307) has the molecular formula C29H37N5O3 and a molecular weight of 503.65 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylcyclohexyl) 3-[4-[1-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-4-yl]phenyl]propanoate.
| Compound Name | (5-methyl-2-propan-2-ylcyclohexyl) 3-[4-[1-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-4-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 70076307 |
| Molecular Formula | C29H37N5O3 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | (5-methyl-2-propan-2-ylcyclohexyl) 3-[4-[1-(4-carbamimidoylphenyl)-3-methyl-5-oxo-1,2,4-triazol-4-yl]phenyl]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(-n2nc(C)n(-c3ccc(CCC(=O)OC4CC(C)CCC4C(C)C)cc3)c2=O)cc1 |
| InChI | InChI=1S/C29H37N5O3/c1-18(2)25-15-5-19(3)17-26(25)37-27(35)16-8-21-6-11-23(12-7-21)33-20(4)32-34(29(33)36)24-13-9-22(10-14-24)28(30)31/h6-7,9-14,18-19,25-26H,5,8,15-17H2,1-4H3,(H3,30,31) |
| InChIKey | FJMNUMQWOZXVBA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 115.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|