C17H22N4O4 — CID 22098391
methyl 4-[3-[2-(4-carbamimidoylphenyl)-2-oxoethyl]-2-oxoimidazolidin-1-yl]butanoate (PubChem CID 22098391) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is methyl 4-[3-[2-(4-carbamimidoylphenyl)-2-oxoethyl]-2-oxoimidazolidin-1-yl]butanoate.
| Compound Name | methyl 4-[3-[2-(4-carbamimidoylphenyl)-2-oxoethyl]-2-oxoimidazolidin-1-yl]butanoate |
|---|---|
| PubChem CID | 22098391 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | methyl 4-[3-[2-(4-carbamimidoylphenyl)-2-oxoethyl]-2-oxoimidazolidin-1-yl]butanoate |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)CN2CCN(CCCC(=O)OC)C2=O)cc1 |
| InChI | InChI=1S/C17H22N4O4/c1-25-15(23)3-2-8-20-9-10-21(17(20)24)11-14(22)12-4-6-13(7-5-12)16(18)19/h4-7H,2-3,8-11H2,1H3,(H3,18,19) |
| InChIKey | MAAVWFLBWXKXBG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 116.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|