C21H24N6O4 — CID 22077582
methyl 5-[2-(4-carbamimidoylphenyl)-5,7-dioxo-1,3,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12)-dien-6-yl]pentanoate (PubChem CID 22077582) has the molecular formula C21H24N6O4 and a molecular weight of 424.46 g/mol. Its IUPAC name is methyl 5-[2-(4-carbamimidoylphenyl)-5,7-dioxo-1,3,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12)-dien-6-yl]pentanoate.
| Compound Name | methyl 5-[2-(4-carbamimidoylphenyl)-5,7-dioxo-1,3,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12)-dien-6-yl]pentanoate |
|---|---|
| PubChem CID | 22077582 |
| Molecular Formula | C21H24N6O4 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | methyl 5-[2-(4-carbamimidoylphenyl)-5,7-dioxo-1,3,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12)-dien-6-yl]pentanoate |
| SMILES | [H]/N=C(\N)c1ccc(-c2nc3c(=O)n(CCCCC(=O)OC)c(=O)n4c3n2CCC4)cc1 |
| InChI | InChI=1S/C21H24N6O4/c1-31-15(28)5-2-3-10-27-20(29)16-19-25(11-4-12-26(19)21(27)30)18(24-16)14-8-6-13(7-9-14)17(22)23/h6-9H,2-5,10-12H2,1H3,(H3,22,23) |
| InChIKey | NHCYCOAQYSWGRJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 137.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|