C25H33N7O5 — CID 22077526
methyl 5-[8-(4-carbamimidoylphenyl)-3-methyl-9-(2-morpholin-4-ylethyl)-2,6-dioxopurin-1-yl]pentanoate (PubChem CID 22077526) has the molecular formula C25H33N7O5 and a molecular weight of 511.58 g/mol. Its IUPAC name is methyl 5-[8-(4-carbamimidoylphenyl)-3-methyl-9-(2-morpholin-4-ylethyl)-2,6-dioxopurin-1-yl]pentanoate.
| Compound Name | methyl 5-[8-(4-carbamimidoylphenyl)-3-methyl-9-(2-morpholin-4-ylethyl)-2,6-dioxopurin-1-yl]pentanoate |
|---|---|
| PubChem CID | 22077526 |
| Molecular Formula | C25H33N7O5 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | methyl 5-[8-(4-carbamimidoylphenyl)-3-methyl-9-(2-morpholin-4-ylethyl)-2,6-dioxopurin-1-yl]pentanoate |
| SMILES | [H]/N=C(\N)c1ccc(-c2nc3c(=O)n(CCCCC(=O)OC)c(=O)n(C)c3n2CCN2CCOCC2)cc1 |
| InChI | InChI=1S/C25H33N7O5/c1-29-23-20(24(34)32(25(29)35)10-4-3-5-19(33)36-2)28-22(18-8-6-17(7-9-18)21(26)27)31(23)12-11-30-13-15-37-16-14-30/h6-9H,3-5,10-16H2,1-2H3,(H3,26,27) |
| InChIKey | MNCTWPSSDXBCPZ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 150.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|