C24H32Br2N6O4 — CID 22077652
5-[8-(4-carbamimidoylphenyl)-9-cyclohexyl-3-methyl-2,6-dioxopurin-1-yl]pentanoic acid;dihydrobromide (PubChem CID 22077652) has the molecular formula C24H32Br2N6O4 and a molecular weight of 628.37 g/mol. Its IUPAC name is 5-[8-(4-carbamimidoylphenyl)-9-cyclohexyl-3-methyl-2,6-dioxopurin-1-yl]pentanoic acid;dihydrobromide.
| Compound Name | 5-[8-(4-carbamimidoylphenyl)-9-cyclohexyl-3-methyl-2,6-dioxopurin-1-yl]pentanoic acid;dihydrobromide |
|---|---|
| PubChem CID | 22077652 |
| Molecular Formula | C24H32Br2N6O4 |
| Molecular Weight | 628.37 g/mol |
| Exact Mass | 626.09 |
| IUPAC Name | 5-[8-(4-carbamimidoylphenyl)-9-cyclohexyl-3-methyl-2,6-dioxopurin-1-yl]pentanoic acid;dihydrobromide |
| SMILES | Br.Br.[H]/N=C(\N)c1ccc(-c2nc3c(=O)n(CCCCC(=O)O)c(=O)n(C)c3n2C2CCCCC2)cc1 |
| InChI | InChI=1S/C24H30N6O4.2BrH/c1-28-22-19(23(33)29(24(28)34)14-6-5-9-18(31)32)27-21(30(22)17-7-3-2-4-8-17)16-12-10-15(11-13-16)20(25)26;;/h10-13,17H,2-9,14H2,1H3,(H3,25,26)(H,31,32);2*1H |
| InChIKey | PURTUJCHFYYQTG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 148.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|