C21H26N6O4 — CID 22077588
methyl 5-[8-(4-carbamimidoylphenyl)-2,6-dioxo-9-propan-2-yl-3H-purin-1-yl]pentanoate (PubChem CID 22077588) has the molecular formula C21H26N6O4 and a molecular weight of 426.48 g/mol. Its IUPAC name is methyl 5-[8-(4-carbamimidoylphenyl)-2,6-dioxo-9-propan-2-yl-3H-purin-1-yl]pentanoate.
| Compound Name | methyl 5-[8-(4-carbamimidoylphenyl)-2,6-dioxo-9-propan-2-yl-3H-purin-1-yl]pentanoate |
|---|---|
| PubChem CID | 22077588 |
| Molecular Formula | C21H26N6O4 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | methyl 5-[8-(4-carbamimidoylphenyl)-2,6-dioxo-9-propan-2-yl-3H-purin-1-yl]pentanoate |
| SMILES | [H]/N=C(\N)c1ccc(-c2nc3c(=O)n(CCCCC(=O)OC)c(=O)[nH]c3n2C(C)C)cc1 |
| InChI | InChI=1S/C21H26N6O4/c1-12(2)27-18(14-9-7-13(8-10-14)17(22)23)24-16-19(27)25-21(30)26(20(16)29)11-5-4-6-15(28)31-3/h7-10,12H,4-6,11H2,1-3H3,(H3,22,23)(H,25,30) |
| InChIKey | LHXUNZWKKKEIAN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 148.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|