C21H23N5O3 — CID 19921160
methyl 3-[[2-(4-carbamimidoylphenyl)-1-methylbenzimidazole-5-carbonyl]-methylamino]propanoate (PubChem CID 19921160) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is methyl 3-[[2-(4-carbamimidoylphenyl)-1-methylbenzimidazole-5-carbonyl]-methylamino]propanoate.
| Compound Name | methyl 3-[[2-(4-carbamimidoylphenyl)-1-methylbenzimidazole-5-carbonyl]-methylamino]propanoate |
|---|---|
| PubChem CID | 19921160 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | methyl 3-[[2-(4-carbamimidoylphenyl)-1-methylbenzimidazole-5-carbonyl]-methylamino]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(-c2nc3cc(C(=O)N(C)CCC(=O)OC)ccc3n2C)cc1 |
| InChI | InChI=1S/C21H23N5O3/c1-25(11-10-18(27)29-3)21(28)15-8-9-17-16(12-15)24-20(26(17)2)14-6-4-13(5-7-14)19(22)23/h4-9,12H,10-11H2,1-3H3,(H3,22,23) |
| InChIKey | JMPDNWCGVRZKBK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|