C28H36ClN5O3 — CID 18412709
ethyl 3-[[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]-cyclopentylamino]propanoate;hydrochloride (PubChem CID 18412709) has the molecular formula C28H36ClN5O3 and a molecular weight of 526.08 g/mol. Its IUPAC name is ethyl 3-[[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]-cyclopentylamino]propanoate;hydrochloride.
| Compound Name | ethyl 3-[[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]-cyclopentylamino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 18412709 |
| Molecular Formula | C28H36ClN5O3 |
| Molecular Weight | 526.08 g/mol |
| Exact Mass | 525.25 |
| IUPAC Name | ethyl 3-[[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazole-5-carbonyl]-cyclopentylamino]propanoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(CCc2nc3cc(C(=O)N(CCC(=O)OCC)C4CCCC4)ccc3n2C)cc1 |
| InChI | InChI=1S/C28H35N5O3.ClH/c1-3-36-26(34)16-17-33(22-6-4-5-7-22)28(35)21-13-14-24-23(18-21)31-25(32(24)2)15-10-19-8-11-20(12-9-19)27(29)30;/h8-9,11-14,18,22H,3-7,10,15-17H2,1-2H3,(H3,29,30);1H |
| InChIKey | CCRDGKLYNTYRHI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.08 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|