C23H30ClN5O4S — CID 23302682
ethyl 3-[[2-[(4-carbamimidoylphenyl)methyl]-1-methylbenzimidazol-5-yl]sulfonyl-ethylamino]propanoate;hydrochloride (PubChem CID 23302682) has the molecular formula C23H30ClN5O4S and a molecular weight of 508.04 g/mol. Its IUPAC name is ethyl 3-[[2-[(4-carbamimidoylphenyl)methyl]-1-methylbenzimidazol-5-yl]sulfonyl-ethylamino]propanoate;hydrochloride.
| Compound Name | ethyl 3-[[2-[(4-carbamimidoylphenyl)methyl]-1-methylbenzimidazol-5-yl]sulfonyl-ethylamino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 23302682 |
| Molecular Formula | C23H30ClN5O4S |
| Molecular Weight | 508.04 g/mol |
| Exact Mass | 507.17 |
| IUPAC Name | ethyl 3-[[2-[(4-carbamimidoylphenyl)methyl]-1-methylbenzimidazol-5-yl]sulfonyl-ethylamino]propanoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(Cc2nc3cc(S(=O)(=O)N(CC)CCC(=O)OCC)ccc3n2C)cc1 |
| InChI | InChI=1S/C23H29N5O4S.ClH/c1-4-28(13-12-22(29)32-5-2)33(30,31)18-10-11-20-19(15-18)26-21(27(20)3)14-16-6-8-17(9-7-16)23(24)25;/h6-11,15H,4-5,12-14H2,1-3H3,(H3,24,25);1H |
| InChIKey | FGRNQCUULDGKSB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 131.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.04 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|