C28H28N4O4S — CID 23302243
ethyl 4-(N-[2-[(4-cyanophenyl)methyl]-1-methylbenzimidazol-5-yl]sulfonylanilino)butanoate (PubChem CID 23302243) has the molecular formula C28H28N4O4S and a molecular weight of 516.62 g/mol. Its IUPAC name is ethyl 4-(N-[2-[(4-cyanophenyl)methyl]-1-methylbenzimidazol-5-yl]sulfonylanilino)butanoate.
| Compound Name | ethyl 4-(N-[2-[(4-cyanophenyl)methyl]-1-methylbenzimidazol-5-yl]sulfonylanilino)butanoate |
|---|---|
| PubChem CID | 23302243 |
| Molecular Formula | C28H28N4O4S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | ethyl 4-(N-[2-[(4-cyanophenyl)methyl]-1-methylbenzimidazol-5-yl]sulfonylanilino)butanoate |
| SMILES | CCOC(=O)CCCN(c1ccccc1)S(=O)(=O)c1ccc2c(c1)nc(Cc1ccc(C#N)cc1)n2C |
| InChI | InChI=1S/C28H28N4O4S/c1-3-36-28(33)10-7-17-32(23-8-5-4-6-9-23)37(34,35)24-15-16-26-25(19-24)30-27(31(26)2)18-21-11-13-22(20-29)14-12-21/h4-6,8-9,11-16,19H,3,7,10,17-18H2,1-2H3 |
| InChIKey | PIKYTTFMRSICRJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 105.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |