C29H36Cl2N6O4S — CID 23302859
ethyl 2-[5-[benzenesulfonyl-[2-(dimethylamino)ethyl]amino]-2-[(4-carbamimidoylphenyl)methyl]benzimidazol-1-yl]acetate;dihydrochloride (PubChem CID 23302859) has the molecular formula C29H36Cl2N6O4S and a molecular weight of 635.62 g/mol. Its IUPAC name is ethyl 2-[5-[benzenesulfonyl-[2-(dimethylamino)ethyl]amino]-2-[(4-carbamimidoylphenyl)methyl]benzimidazol-1-yl]acetate;dihydrochloride.
| Compound Name | ethyl 2-[5-[benzenesulfonyl-[2-(dimethylamino)ethyl]amino]-2-[(4-carbamimidoylphenyl)methyl]benzimidazol-1-yl]acetate;dihydrochloride |
|---|---|
| PubChem CID | 23302859 |
| Molecular Formula | C29H36Cl2N6O4S |
| Molecular Weight | 635.62 g/mol |
| Exact Mass | 634.19 |
| IUPAC Name | ethyl 2-[5-[benzenesulfonyl-[2-(dimethylamino)ethyl]amino]-2-[(4-carbamimidoylphenyl)methyl]benzimidazol-1-yl]acetate;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc(Cc2nc3cc(N(CCN(C)C)S(=O)(=O)c4ccccc4)ccc3n2CC(=O)OCC)cc1 |
| InChI | InChI=1S/C29H34N6O4S.2ClH/c1-4-39-28(36)20-34-26-15-14-23(35(17-16-33(2)3)40(37,38)24-8-6-5-7-9-24)19-25(26)32-27(34)18-21-10-12-22(13-11-21)29(30)31;;/h5-15,19H,4,16-18,20H2,1-3H3,(H3,30,31);2*1H |
| InChIKey | MSKDGZYJUTYIED-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 134.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.62 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|