C34H38Cl2N6O2S — CID 70287355
4-[[5-[benzenesulfonyl(2-pyrrolidin-1-ylethyl)amino]-1-benzylbenzimidazol-2-yl]methyl]benzenecarboximidamide;dihydrochloride (PubChem CID 70287355) has the molecular formula C34H38Cl2N6O2S and a molecular weight of 665.69 g/mol. Its IUPAC name is 4-[[5-[benzenesulfonyl(2-pyrrolidin-1-ylethyl)amino]-1-benzylbenzimidazol-2-yl]methyl]benzenecarboximidamide;dihydrochloride.
| Compound Name | 4-[[5-[benzenesulfonyl(2-pyrrolidin-1-ylethyl)amino]-1-benzylbenzimidazol-2-yl]methyl]benzenecarboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 70287355 |
| Molecular Formula | C34H38Cl2N6O2S |
| Molecular Weight | 665.69 g/mol |
| Exact Mass | 664.22 |
| IUPAC Name | 4-[[5-[benzenesulfonyl(2-pyrrolidin-1-ylethyl)amino]-1-benzylbenzimidazol-2-yl]methyl]benzenecarboximidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc(Cc2nc3cc(N(CCN4CCCC4)S(=O)(=O)c4ccccc4)ccc3n2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C34H36N6O2S.2ClH/c35-34(36)28-15-13-26(14-16-28)23-33-37-31-24-29(17-18-32(31)39(33)25-27-9-3-1-4-10-27)40(22-21-38-19-7-8-20-38)43(41,42)30-11-5-2-6-12-30;;/h1-6,9-18,24H,7-8,19-23,25H2,(H3,35,36);2*1H |
| InChIKey | YWIGZIKHVWGZEF-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.69 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|