C38H46N6O2S — CID 18473753
4-[2-[5-[2-(diethylamino)ethyl-[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]-1-methylbenzimidazol-2-yl]ethyl]benzenecarboximidamide (PubChem CID 18473753) has the molecular formula C38H46N6O2S and a molecular weight of 650.89 g/mol. Its IUPAC name is 4-[2-[5-[2-(diethylamino)ethyl-[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]-1-methylbenzimidazol-2-yl]ethyl]benzenecarboximidamide.
| Compound Name | 4-[2-[5-[2-(diethylamino)ethyl-[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]-1-methylbenzimidazol-2-yl]ethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 18473753 |
| Molecular Formula | C38H46N6O2S |
| Molecular Weight | 650.89 g/mol |
| Exact Mass | 650.34 |
| IUPAC Name | 4-[2-[5-[2-(diethylamino)ethyl-[3-(2-phenylpropan-2-yl)phenyl]sulfonylamino]-1-methylbenzimidazol-2-yl]ethyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(N(CCN(CC)CC)S(=O)(=O)c4cccc(C(C)(C)c5ccccc5)c4)ccc3n2C)cc1 |
| InChI | InChI=1S/C38H46N6O2S/c1-6-43(7-2)24-25-44(47(45,46)33-15-11-14-31(26-33)38(3,4)30-12-9-8-10-13-30)32-21-22-35-34(27-32)41-36(42(35)5)23-18-28-16-19-29(20-17-28)37(39)40/h8-17,19-22,26-27H,6-7,18,23-25H2,1-5H3,(H3,39,40) |
| InChIKey | VQGKCAIYEVESIL-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.89 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|