C35H38N6O2S — CID 22621820
4-[2-[5-[benzenesulfonyl-[(1-benzylpyrrolidin-3-yl)methyl]amino]-1-methylbenzimidazol-2-yl]ethyl]benzenecarboximidamide (PubChem CID 22621820) has the molecular formula C35H38N6O2S and a molecular weight of 606.80 g/mol. Its IUPAC name is 4-[2-[5-[benzenesulfonyl-[(1-benzylpyrrolidin-3-yl)methyl]amino]-1-methylbenzimidazol-2-yl]ethyl]benzenecarboximidamide.
| Compound Name | 4-[2-[5-[benzenesulfonyl-[(1-benzylpyrrolidin-3-yl)methyl]amino]-1-methylbenzimidazol-2-yl]ethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 22621820 |
| Molecular Formula | C35H38N6O2S |
| Molecular Weight | 606.80 g/mol |
| Exact Mass | 606.28 |
| IUPAC Name | 4-[2-[5-[benzenesulfonyl-[(1-benzylpyrrolidin-3-yl)methyl]amino]-1-methylbenzimidazol-2-yl]ethyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(N(CC4CCN(Cc5ccccc5)C4)S(=O)(=O)c4ccccc4)ccc3n2C)cc1 |
| InChI | InChI=1S/C35H38N6O2S/c1-39-33-18-17-30(22-32(33)38-34(39)19-14-26-12-15-29(16-13-26)35(36)37)41(44(42,43)31-10-6-3-7-11-31)25-28-20-21-40(24-28)23-27-8-4-2-5-9-27/h2-13,15-18,22,28H,14,19-21,23-25H2,1H3,(H3,36,37) |
| InChIKey | GJOOSVHQYAFAHC-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.80 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|