C31H38N6O4S — CID 173270194
methyl N-[4-[2-[5-[benzenesulfonyl-[2-(diethylamino)ethyl]amino]-1-methylbenzimidazol-2-yl]ethyl]benzenecarboximidoyl]carbamate (PubChem CID 173270194) has the molecular formula C31H38N6O4S and a molecular weight of 590.75 g/mol. Its IUPAC name is methyl N-[4-[2-[5-[benzenesulfonyl-[2-(diethylamino)ethyl]amino]-1-methylbenzimidazol-2-yl]ethyl]benzenecarboximidoyl]carbamate.
| Compound Name | methyl N-[4-[2-[5-[benzenesulfonyl-[2-(diethylamino)ethyl]amino]-1-methylbenzimidazol-2-yl]ethyl]benzenecarboximidoyl]carbamate |
|---|---|
| PubChem CID | 173270194 |
| Molecular Formula | C31H38N6O4S |
| Molecular Weight | 590.75 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | methyl N-[4-[2-[5-[benzenesulfonyl-[2-(diethylamino)ethyl]amino]-1-methylbenzimidazol-2-yl]ethyl]benzenecarboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OC)c1ccc(CCc2nc3cc(N(CCN(CC)CC)S(=O)(=O)c4ccccc4)ccc3n2C)cc1 |
| InChI | InChI=1S/C31H38N6O4S/c1-5-36(6-2)20-21-37(42(39,40)26-10-8-7-9-11-26)25-17-18-28-27(22-25)33-29(35(28)3)19-14-23-12-15-24(16-13-23)30(32)34-31(38)41-4/h7-13,15-18,22H,5-6,14,19-21H2,1-4H3,(H2,32,34,38) |
| InChIKey | AVGOJCAUJYHAGT-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.75 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|