C33H39N7O2S — CID 70162588
4-[2-[5-[[5-amino-3-(2-aminoethyl)-2-ethylnaphthalen-1-yl]sulfonyl-ethylamino]-1-methylbenzimidazol-2-yl]ethyl]benzenecarboximidamide (PubChem CID 70162588) has the molecular formula C33H39N7O2S and a molecular weight of 597.79 g/mol. Its IUPAC name is 4-[2-[5-[[5-amino-3-(2-aminoethyl)-2-ethylnaphthalen-1-yl]sulfonyl-ethylamino]-1-methylbenzimidazol-2-yl]ethyl]benzenecarboximidamide.
| Compound Name | 4-[2-[5-[[5-amino-3-(2-aminoethyl)-2-ethylnaphthalen-1-yl]sulfonyl-ethylamino]-1-methylbenzimidazol-2-yl]ethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 70162588 |
| Molecular Formula | C33H39N7O2S |
| Molecular Weight | 597.79 g/mol |
| Exact Mass | 597.29 |
| IUPAC Name | 4-[2-[5-[[5-amino-3-(2-aminoethyl)-2-ethylnaphthalen-1-yl]sulfonyl-ethylamino]-1-methylbenzimidazol-2-yl]ethyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CCc2nc3cc(N(CC)S(=O)(=O)c4c(CC)c(CCN)cc5c(N)cccc45)ccc3n2C)cc1 |
| InChI | InChI=1S/C33H39N7O2S/c1-4-25-23(17-18-34)19-27-26(7-6-8-28(27)35)32(25)43(41,42)40(5-2)24-14-15-30-29(20-24)38-31(39(30)3)16-11-21-9-12-22(13-10-21)33(36)37/h6-10,12-15,19-20H,4-5,11,16-18,34-35H2,1-3H3,(H3,36,37) |
| InChIKey | CTTPIGHYQDOMOR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 157.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.79 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|