C35H40Cl2N6O — CID 70092490
N-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazol-5-yl]-N-(naphthalen-1-ylmethyl)-2-piperidin-1-ylacetamide;dihydrochloride (PubChem CID 70092490) has the molecular formula C35H40Cl2N6O and a molecular weight of 631.65 g/mol. Its IUPAC name is N-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazol-5-yl]-N-(naphthalen-1-ylmethyl)-2-piperidin-1-ylacetamide;dihydrochloride.
| Compound Name | N-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazol-5-yl]-N-(naphthalen-1-ylmethyl)-2-piperidin-1-ylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 70092490 |
| Molecular Formula | C35H40Cl2N6O |
| Molecular Weight | 631.65 g/mol |
| Exact Mass | 630.26 |
| IUPAC Name | N-[2-[2-(4-carbamimidoylphenyl)ethyl]-1-methylbenzimidazol-5-yl]-N-(naphthalen-1-ylmethyl)-2-piperidin-1-ylacetamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc(CCc2nc3cc(N(Cc4cccc5ccccc45)C(=O)CN4CCCCC4)ccc3n2C)cc1 |
| InChI | InChI=1S/C35H38N6O.2ClH/c1-39-32-18-17-29(22-31(32)38-33(39)19-14-25-12-15-27(16-13-25)35(36)37)41(34(42)24-40-20-5-2-6-21-40)23-28-10-7-9-26-8-3-4-11-30(26)28;;/h3-4,7-13,15-18,22H,2,5-6,14,19-21,23-24H2,1H3,(H3,36,37);2*1H |
| InChIKey | ZXUOFCFREGLBDS-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.65 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|