C26H27N5O5S — CID 57163032
ethyl 2-[benzenesulfonyl-[2-[(4-carbamimidoylphenyl)-hydroxymethyl]-1-methylbenzimidazol-5-yl]amino]acetate (PubChem CID 57163032) has the molecular formula C26H27N5O5S and a molecular weight of 521.60 g/mol. Its IUPAC name is ethyl 2-[benzenesulfonyl-[2-[(4-carbamimidoylphenyl)-hydroxymethyl]-1-methylbenzimidazol-5-yl]amino]acetate.
| Compound Name | ethyl 2-[benzenesulfonyl-[2-[(4-carbamimidoylphenyl)-hydroxymethyl]-1-methylbenzimidazol-5-yl]amino]acetate |
|---|---|
| PubChem CID | 57163032 |
| Molecular Formula | C26H27N5O5S |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | ethyl 2-[benzenesulfonyl-[2-[(4-carbamimidoylphenyl)-hydroxymethyl]-1-methylbenzimidazol-5-yl]amino]acetate |
| SMILES | [H]/N=C(\N)c1ccc(C(O)c2nc3cc(N(CC(=O)OCC)S(=O)(=O)c4ccccc4)ccc3n2C)cc1 |
| InChI | InChI=1S/C26H27N5O5S/c1-3-36-23(32)16-31(37(34,35)20-7-5-4-6-8-20)19-13-14-22-21(15-19)29-26(30(22)2)24(33)17-9-11-18(12-10-17)25(27)28/h4-15,24,33H,3,16H2,1-2H3,(H3,27,28) |
| InChIKey | MGKOFKBNHNWIJN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 151.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|