C29H34N6O5S — CID 23296586
ethyl 2-[6-[benzenesulfonyl-[2-(dimethylamino)ethyl]amino]-2-[(4-carbamimidoylphenoxy)methyl]benzimidazol-1-yl]acetate (PubChem CID 23296586) has the molecular formula C29H34N6O5S and a molecular weight of 578.70 g/mol. Its IUPAC name is ethyl 2-[6-[benzenesulfonyl-[2-(dimethylamino)ethyl]amino]-2-[(4-carbamimidoylphenoxy)methyl]benzimidazol-1-yl]acetate.
| Compound Name | ethyl 2-[6-[benzenesulfonyl-[2-(dimethylamino)ethyl]amino]-2-[(4-carbamimidoylphenoxy)methyl]benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 23296586 |
| Molecular Formula | C29H34N6O5S |
| Molecular Weight | 578.70 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | ethyl 2-[6-[benzenesulfonyl-[2-(dimethylamino)ethyl]amino]-2-[(4-carbamimidoylphenoxy)methyl]benzimidazol-1-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(OCc2nc3ccc(N(CCN(C)C)S(=O)(=O)c4ccccc4)cc3n2CC(=O)OCC)cc1 |
| InChI | InChI=1S/C29H34N6O5S/c1-4-39-28(36)19-34-26-18-22(35(17-16-33(2)3)41(37,38)24-8-6-5-7-9-24)12-15-25(26)32-27(34)20-40-23-13-10-21(11-14-23)29(30)31/h5-15,18H,4,16-17,19-20H2,1-3H3,(H3,30,31) |
| InChIKey | RXXQBXFEYLLYQZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.70 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|